C29H45O3PSi — CID 58304689
(Z,2S,7S)-2-[tert-butyl(diphenyl)silyl]oxy-7-(methoxyphosphanylmethyl)undec-4-en-6-ol (PubChem CID 58304689) has the molecular formula C29H45O3PSi and a molecular weight of 500.74 g/mol. Its IUPAC name is (Z,2S,7S)-2-[tert-butyl(diphenyl)silyl]oxy-7-(methoxyphosphanylmethyl)undec-4-en-6-ol.
| Compound Name | (Z,2S,7S)-2-[tert-butyl(diphenyl)silyl]oxy-7-(methoxyphosphanylmethyl)undec-4-en-6-ol |
|---|---|
| PubChem CID | 58304689 |
| Molecular Formula | C29H45O3PSi |
| Molecular Weight | 500.74 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | (Z,2S,7S)-2-[tert-butyl(diphenyl)silyl]oxy-7-(methoxyphosphanylmethyl)undec-4-en-6-ol |
| SMILES | CCCC[C@H](CPOC)C(O)/C=C\C[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H45O3PSi/c1-7-8-17-25(23-33-31-6)28(30)22-15-16-24(2)32-34(29(3,4)5,26-18-11-9-12-19-26)27-20-13-10-14-21-27/h9-15,18-22,24-25,28,30,33H,7-8,16-17,23H2,1-6H3/b22-15-/t24-,25+,28?/m0/s1 |
| InChIKey | UHMSCAQVMZNXRZ-GKEQOZQJSA-N |
| XLogP | 6.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.74 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|