C36H49O4PSi — CID 58304441
[(Z,2S,7S)-2-[tert-butyl(diphenyl)silyl]oxy-7-(methoxyphosphanylmethyl)undec-4-en-6-yl] benzoate (PubChem CID 58304441) has the molecular formula C36H49O4PSi and a molecular weight of 604.84 g/mol. Its IUPAC name is [(Z,2S,7S)-2-[tert-butyl(diphenyl)silyl]oxy-7-(methoxyphosphanylmethyl)undec-4-en-6-yl] benzoate.
| Compound Name | [(Z,2S,7S)-2-[tert-butyl(diphenyl)silyl]oxy-7-(methoxyphosphanylmethyl)undec-4-en-6-yl] benzoate |
|---|---|
| PubChem CID | 58304441 |
| Molecular Formula | C36H49O4PSi |
| Molecular Weight | 604.84 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | [(Z,2S,7S)-2-[tert-butyl(diphenyl)silyl]oxy-7-(methoxyphosphanylmethyl)undec-4-en-6-yl] benzoate |
| SMILES | CCCC[C@H](CPOC)C(/C=C\C[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H49O4PSi/c1-7-8-20-31(28-41-38-6)34(39-35(37)30-21-12-9-13-22-30)27-18-19-29(2)40-42(36(3,4)5,32-23-14-10-15-24-32)33-25-16-11-17-26-33/h9-18,21-27,29,31,34,41H,7-8,19-20,28H2,1-6H3/b27-18-/t29-,31+,34?/m0/s1 |
| InChIKey | DMVCTXUIARTTPN-WJRKMSJOSA-N |
| XLogP | 8.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.84 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|