C47H58O8Si — CID 173472268
ethyl 2-[(1E,5S,7Z)-6-benzoyloxy-10-[tert-butyl(diphenyl)silyl]oxy-5-methylundeca-1,7-dienyl]-4-methoxy-6-(methoxymethoxy)benzoate (PubChem CID 173472268) has the molecular formula C47H58O8Si and a molecular weight of 779.06 g/mol. Its IUPAC name is ethyl 2-[(1E,5S,7Z)-6-benzoyloxy-10-[tert-butyl(diphenyl)silyl]oxy-5-methylundeca-1,7-dienyl]-4-methoxy-6-(methoxymethoxy)benzoate.
| Compound Name | ethyl 2-[(1E,5S,7Z)-6-benzoyloxy-10-[tert-butyl(diphenyl)silyl]oxy-5-methylundeca-1,7-dienyl]-4-methoxy-6-(methoxymethoxy)benzoate |
|---|---|
| PubChem CID | 173472268 |
| Molecular Formula | C47H58O8Si |
| Molecular Weight | 779.06 g/mol |
| Exact Mass | 778.39 |
| IUPAC Name | ethyl 2-[(1E,5S,7Z)-6-benzoyloxy-10-[tert-butyl(diphenyl)silyl]oxy-5-methylundeca-1,7-dienyl]-4-methoxy-6-(methoxymethoxy)benzoate |
| SMILES | CCOC(=O)c1c(/C=C/CC[C@H](C)C(/C=C\CC(C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(=O)c2ccccc2)cc(OC)cc1OCOC |
| InChI | InChI=1S/C47H58O8Si/c1-9-52-46(49)44-38(32-39(51-8)33-43(44)53-34-50-7)26-20-19-22-35(2)42(54-45(48)37-24-13-10-14-25-37)31-21-23-36(3)55-56(47(4,5)6,40-27-15-11-16-28-40)41-29-17-12-18-30-41/h10-18,20-21,24-33,35-36,42H,9,19,22-23,34H2,1-8H3/b26-20+,31-21-/t35-,36?,42?/m0/s1 |
| InChIKey | MEWYZGRAJSAFSR-HHYFYSTDSA-N |
| XLogP | 9.42 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.06 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|