C37H52O12SSi — CID 91102105
2-trimethylsilylethyl 2-[3-[(4S,5S)-5-[(5R)-1-benzoyloxy-5-methylsulfonyloxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoate (PubChem CID 91102105) has the molecular formula C37H52O12SSi and a molecular weight of 748.96 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[3-[(4S,5S)-5-[(5R)-1-benzoyloxy-5-methylsulfonyloxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoate.
| Compound Name | 2-trimethylsilylethyl 2-[3-[(4S,5S)-5-[(5R)-1-benzoyloxy-5-methylsulfonyloxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoate |
|---|---|
| PubChem CID | 91102105 |
| Molecular Formula | C37H52O12SSi |
| Molecular Weight | 748.96 g/mol |
| Exact Mass | 748.29 |
| IUPAC Name | 2-trimethylsilylethyl 2-[3-[(4S,5S)-5-[(5R)-1-benzoyloxy-5-methylsulfonyloxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoate |
| SMILES | COCOc1cc(OC)cc(C=CC[C@@H]2OC(C)(C)O[C@@H]2C(C=CC[C@@H](C)OS(C)(=O)=O)OC(=O)c2ccccc2)c1C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C37H52O12SSi/c1-26(49-50(6,40)41)15-13-19-30(46-35(38)27-16-11-10-12-17-27)34-31(47-37(2,3)48-34)20-14-18-28-23-29(43-5)24-32(45-25-42-4)33(28)36(39)44-21-22-51(7,8)9/h10-14,16-19,23-24,26,30-31,34H,15,20-22,25H2,1-9H3/t26-,30?,31+,34-/m1/s1 |
| InChIKey | KXNFMEZNXXARCQ-XYXNSYHOSA-N |
| XLogP | 6.63 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.96 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|