C33H40O10 — CID 90979503
2-[3-[(4S,5S)-5-[1-benzoyloxy-3-[(1S,2R)-2-hydroxycyclopentyl]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoic acid (PubChem CID 90979503) has the molecular formula C33H40O10 and a molecular weight of 596.67 g/mol. Its IUPAC name is 2-[3-[(4S,5S)-5-[1-benzoyloxy-3-[(1S,2R)-2-hydroxycyclopentyl]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoic acid.
| Compound Name | 2-[3-[(4S,5S)-5-[1-benzoyloxy-3-[(1S,2R)-2-hydroxycyclopentyl]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 90979503 |
| Molecular Formula | C33H40O10 |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | 2-[3-[(4S,5S)-5-[1-benzoyloxy-3-[(1S,2R)-2-hydroxycyclopentyl]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoic acid |
| SMILES | COCOc1cc(OC)cc(C=CC[C@@H]2OC(C)(C)O[C@@H]2C(C=C[C@@H]2CCC[C@H]2O)OC(=O)c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C33H40O10/c1-33(2)42-27(15-9-13-23-18-24(39-4)19-28(40-20-38-3)29(23)31(35)36)30(43-33)26(17-16-21-12-8-14-25(21)34)41-32(37)22-10-6-5-7-11-22/h5-7,9-11,13,16-19,21,25-27,30,34H,8,12,14-15,20H2,1-4H3,(H,35,36)/t21-,25+,26?,27-,30+/m0/s1 |
| InChIKey | NMMWVFAKTXOEGP-JEQGQERYSA-N |
| XLogP | 5.24 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|