C33H43N3O10 — CID 58304765
4-(2-azidoethoxy)-2-[(E)-3-[(5S)-5-[(1R,4R,5S)-1-benzoyloxy-5-hydroxy-4-methylhexyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)benzoic acid (PubChem CID 58304765) has the molecular formula C33H43N3O10 and a molecular weight of 641.72 g/mol. Its IUPAC name is 4-(2-azidoethoxy)-2-[(E)-3-[(5S)-5-[(1R,4R,5S)-1-benzoyloxy-5-hydroxy-4-methylhexyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)benzoic acid.
| Compound Name | 4-(2-azidoethoxy)-2-[(E)-3-[(5S)-5-[(1R,4R,5S)-1-benzoyloxy-5-hydroxy-4-methylhexyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 58304765 |
| Molecular Formula | C33H43N3O10 |
| Molecular Weight | 641.72 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | 4-(2-azidoethoxy)-2-[(E)-3-[(5S)-5-[(1R,4R,5S)-1-benzoyloxy-5-hydroxy-4-methylhexyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-6-(methoxymethoxy)benzoic acid |
| SMILES | COCOc1cc(OCCN=[N+]=[N-])cc(/C=C/CC2OC(C)(C)O[C@@H]2[C@@H](CC[C@@H](C)[C@H](C)O)OC(=O)c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C33H43N3O10/c1-21(22(2)37)14-15-26(44-32(40)23-10-7-6-8-11-23)30-27(45-33(3,4)46-30)13-9-12-24-18-25(42-17-16-35-36-34)19-28(43-20-41-5)29(24)31(38)39/h6-12,18-19,21-22,26-27,30,37H,13-17,20H2,1-5H3,(H,38,39)/b12-9+/t21-,22+,26-,27?,30-/m1/s1 |
| InChIKey | HCLYHUSDSZHCIT-SGDPYKRRSA-N |
| XLogP | 6.00 |
| TPSA | 178.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.72 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|