C34H50O9Si — CID 89283714
2-trimethylsilylethyl 2-[(E)-3-[(4S,5R)-5-[(2R,3S)-2-benzyl-1,3-dihydroxybutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoate (PubChem CID 89283714) has the molecular formula C34H50O9Si and a molecular weight of 630.85 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(E)-3-[(4S,5R)-5-[(2R,3S)-2-benzyl-1,3-dihydroxybutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoate.
| Compound Name | 2-trimethylsilylethyl 2-[(E)-3-[(4S,5R)-5-[(2R,3S)-2-benzyl-1,3-dihydroxybutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoate |
|---|---|
| PubChem CID | 89283714 |
| Molecular Formula | C34H50O9Si |
| Molecular Weight | 630.85 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(E)-3-[(4S,5R)-5-[(2R,3S)-2-benzyl-1,3-dihydroxybutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4-methoxy-6-(methoxymethoxy)benzoate |
| SMILES | COCOc1cc(OC)cc(/C=C/C[C@@H]2OC(C)(C)O[C@@H]2C(O)[C@H](Cc2ccccc2)[C@H](C)O)c1C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C34H50O9Si/c1-23(35)27(19-24-13-10-9-11-14-24)31(36)32-28(42-34(2,3)43-32)16-12-15-25-20-26(39-5)21-29(41-22-38-4)30(25)33(37)40-17-18-44(6,7)8/h9-15,20-21,23,27-28,31-32,35-36H,16-19,22H2,1-8H3/b15-12+/t23-,27+,28-,31?,32-/m0/s1 |
| InChIKey | ABPLGDKZDGEBEX-QQXHLABKSA-N |
| XLogP | 5.70 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.85 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|