C44H54O9Si — CID 90195735
methyl 2-[3-[(4R,5R)-5-[(Z,5R)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-4-methoxy-6-(methoxymethoxy)benzoate (PubChem CID 90195735) has the molecular formula C44H54O9Si and a molecular weight of 754.99 g/mol. Its IUPAC name is methyl 2-[3-[(4R,5R)-5-[(Z,5R)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-4-methoxy-6-(methoxymethoxy)benzoate.
| Compound Name | methyl 2-[3-[(4R,5R)-5-[(Z,5R)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-4-methoxy-6-(methoxymethoxy)benzoate |
|---|---|
| PubChem CID | 90195735 |
| Molecular Formula | C44H54O9Si |
| Molecular Weight | 754.99 g/mol |
| Exact Mass | 754.35 |
| IUPAC Name | methyl 2-[3-[(4R,5R)-5-[(Z,5R)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-4-methoxy-6-(methoxymethoxy)benzoate |
| SMILES | COCOc1cc(OC)cc(-c2cccc([C@H]3OC(C)(C)O[C@@H]3C(O)/C=C\C[C@@H](C)O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c2)c1C(=O)OC |
| InChI | InChI=1S/C44H54O9Si/c1-30(53-54(43(2,3)4,34-21-12-10-13-22-34)35-23-14-11-15-24-35)18-16-25-37(45)41-40(51-44(5,6)52-41)32-20-17-19-31(26-32)36-27-33(48-8)28-38(50-29-47-7)39(36)42(46)49-9/h10-17,19-28,30,37,40-41,45H,18,29H2,1-9H3/b25-16-/t30-,37?,40-,41-/m1/s1 |
| InChIKey | DZUZCTCKLGXVCS-YGJSYGHJSA-N |
| XLogP | 7.60 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.99 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|