C46H57O5PSi — CID 58304461
[(1E,5S,7Z,10S)-1-(2-acetyl-3,5-dimethylphenyl)-10-[tert-butyl(diphenyl)silyl]oxy-5-(methoxyphosphanylmethyl)undeca-1,7-dien-6-yl] benzoate (PubChem CID 58304461) has the molecular formula C46H57O5PSi and a molecular weight of 749.02 g/mol. Its IUPAC name is [(1E,5S,7Z,10S)-1-(2-acetyl-3,5-dimethylphenyl)-10-[tert-butyl(diphenyl)silyl]oxy-5-(methoxyphosphanylmethyl)undeca-1,7-dien-6-yl] benzoate.
| Compound Name | [(1E,5S,7Z,10S)-1-(2-acetyl-3,5-dimethylphenyl)-10-[tert-butyl(diphenyl)silyl]oxy-5-(methoxyphosphanylmethyl)undeca-1,7-dien-6-yl] benzoate |
|---|---|
| PubChem CID | 58304461 |
| Molecular Formula | C46H57O5PSi |
| Molecular Weight | 749.02 g/mol |
| Exact Mass | 748.37 |
| IUPAC Name | [(1E,5S,7Z,10S)-1-(2-acetyl-3,5-dimethylphenyl)-10-[tert-butyl(diphenyl)silyl]oxy-5-(methoxyphosphanylmethyl)undeca-1,7-dien-6-yl] benzoate |
| SMILES | COPCC(CC/C=C/c1cc(C)cc(C)c1C(C)=O)C(/C=C\C[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C46H57O5PSi/c1-34-31-35(2)44(37(4)47)39(32-34)24-18-19-25-40(33-52-49-8)43(50-45(48)38-22-12-9-13-23-38)30-20-21-36(3)51-53(46(5,6)7,41-26-14-10-15-27-41)42-28-16-11-17-29-42/h9-18,20,22-24,26-32,36,40,43,52H,19,21,25,33H2,1-8H3/b24-18+,30-20-/t36-,40?,43?/m0/s1 |
| InChIKey | YVLMUTBTNNXKHK-DMPCBUNNSA-N |
| XLogP | 10.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.02 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|