C26H40OSSi — CID 134846418
tert-butyl-[(2R,5S)-5-butylsulfanylhexan-2-yl]oxy-diphenylsilane (PubChem CID 134846418) has the molecular formula C26H40OSSi and a molecular weight of 428.76 g/mol. Its IUPAC name is tert-butyl-[(2R,5S)-5-butylsulfanylhexan-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2R,5S)-5-butylsulfanylhexan-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 134846418 |
| Molecular Formula | C26H40OSSi |
| Molecular Weight | 428.76 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | tert-butyl-[(2R,5S)-5-butylsulfanylhexan-2-yl]oxy-diphenylsilane |
| SMILES | CCCCS[C@@H](C)CC[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H40OSSi/c1-7-8-21-28-23(3)20-19-22(2)27-29(26(4,5)6,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18,22-23H,7-8,19-21H2,1-6H3/t22-,23+/m1/s1 |
| InChIKey | WCIQGVJWGKSWLU-PKTZIBPZSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.76 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|