C27H40O2Si — CID 134834787
(10R)-10-[tert-butyl(diphenyl)silyl]oxyundec-1-en-6-ol (PubChem CID 134834787) has the molecular formula C27H40O2Si and a molecular weight of 424.70 g/mol. Its IUPAC name is (10R)-10-[tert-butyl(diphenyl)silyl]oxyundec-1-en-6-ol.
| Compound Name | (10R)-10-[tert-butyl(diphenyl)silyl]oxyundec-1-en-6-ol |
|---|---|
| PubChem CID | 134834787 |
| Molecular Formula | C27H40O2Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (10R)-10-[tert-butyl(diphenyl)silyl]oxyundec-1-en-6-ol |
| SMILES | C=CCCCC(O)CCC[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40O2Si/c1-6-7-10-17-24(28)18-15-16-23(2)29-30(27(3,4)5,25-19-11-8-12-20-25)26-21-13-9-14-22-26/h6,8-9,11-14,19-24,28H,1,7,10,15-18H2,2-5H3/t23-,24?/m1/s1 |
| InChIKey | IGPMBMKKQXQSCJ-MIHMCVIASA-N |
| XLogP | 5.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|