C28H42O2Si — CID 168962199
12-[tert-butyl(diphenyl)silyl]oxydodec-1-en-6-ol (PubChem CID 168962199) has the molecular formula C28H42O2Si and a molecular weight of 438.73 g/mol. Its IUPAC name is 12-[tert-butyl(diphenyl)silyl]oxydodec-1-en-6-ol.
| Compound Name | 12-[tert-butyl(diphenyl)silyl]oxydodec-1-en-6-ol |
|---|---|
| PubChem CID | 168962199 |
| Molecular Formula | C28H42O2Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 12-[tert-butyl(diphenyl)silyl]oxydodec-1-en-6-ol |
| SMILES | C=CCCCC(O)CCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H42O2Si/c1-5-6-11-18-25(29)19-12-7-8-17-24-30-31(28(2,3)4,26-20-13-9-14-21-26)27-22-15-10-16-23-27/h5,9-10,13-16,20-23,25,29H,1,6-8,11-12,17-19,24H2,2-4H3 |
| InChIKey | PYCDZAUOGAFWLX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|