C24H31Br3O2Si — CID 11828260
(3R,4S)-1,1,3-tribromo-8-[tert-butyl(diphenyl)silyl]oxyoct-1-en-4-ol (PubChem CID 11828260) has the molecular formula C24H31Br3O2Si and a molecular weight of 619.31 g/mol. Its IUPAC name is (3R,4S)-1,1,3-tribromo-8-[tert-butyl(diphenyl)silyl]oxyoct-1-en-4-ol.
| Compound Name | (3R,4S)-1,1,3-tribromo-8-[tert-butyl(diphenyl)silyl]oxyoct-1-en-4-ol |
|---|---|
| PubChem CID | 11828260 |
| Molecular Formula | C24H31Br3O2Si |
| Molecular Weight | 619.31 g/mol |
| Exact Mass | 615.96 |
| IUPAC Name | (3R,4S)-1,1,3-tribromo-8-[tert-butyl(diphenyl)silyl]oxyoct-1-en-4-ol |
| SMILES | CC(C)(C)[Si](OCCCC[C@H](O)[C@H](Br)C=C(Br)Br)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31Br3O2Si/c1-24(2,3)30(19-12-6-4-7-13-19,20-14-8-5-9-15-20)29-17-11-10-16-22(28)21(25)18-23(26)27/h4-9,12-15,18,21-22,28H,10-11,16-17H2,1-3H3/t21-,22+/m1/s1 |
| InChIKey | YUOVBIXBQQCQJG-YADHBBJMSA-N |
| XLogP | 6.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.31 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|