C29H40O2Si — CID 101058434
4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-ethenylocta-1,7-dien-3-ol (PubChem CID 101058434) has the molecular formula C29H40O2Si and a molecular weight of 448.72 g/mol. Its IUPAC name is 4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-ethenylocta-1,7-dien-3-ol.
| Compound Name | 4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-ethenylocta-1,7-dien-3-ol |
|---|---|
| PubChem CID | 101058434 |
| Molecular Formula | C29H40O2Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-ethenylocta-1,7-dien-3-ol |
| SMILES | C=CCCC(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(O)(C=C)C=C |
| InChI | InChI=1S/C29H40O2Si/c1-7-10-18-25(29(30,8-2)9-3)19-17-24-31-32(28(4,5)6,26-20-13-11-14-21-26)27-22-15-12-16-23-27/h7-9,11-16,20-23,25,30H,1-3,10,17-19,24H2,4-6H3 |
| InChIKey | LXFXEXMYWZWYDP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|