C33H39NO3Si — CID 11071459
2-[(2R,4R)-2-[tert-butyl(diphenyl)silyl]oxynon-8-en-4-yl]isoindole-1,3-dione (PubChem CID 11071459) has the molecular formula C33H39NO3Si and a molecular weight of 525.77 g/mol. Its IUPAC name is 2-[(2R,4R)-2-[tert-butyl(diphenyl)silyl]oxynon-8-en-4-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,4R)-2-[tert-butyl(diphenyl)silyl]oxynon-8-en-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11071459 |
| Molecular Formula | C33H39NO3Si |
| Molecular Weight | 525.77 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 2-[(2R,4R)-2-[tert-butyl(diphenyl)silyl]oxynon-8-en-4-yl]isoindole-1,3-dione |
| SMILES | C=CCCC[C@H](C[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C33H39NO3Si/c1-6-7-10-17-26(34-31(35)29-22-15-16-23-30(29)32(34)36)24-25(2)37-38(33(3,4)5,27-18-11-8-12-19-27)28-20-13-9-14-21-28/h6,8-9,11-16,18-23,25-26H,1,7,10,17,24H2,2-5H3/t25-,26-/m1/s1 |
| InChIKey | XJFLDABTAYDEPQ-CLJLJLNGSA-N |
| XLogP | 6.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.77 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|