C19H23NO2 — CID 11323980
2-undeca-1,10-dien-6-ylisoindole-1,3-dione (PubChem CID 11323980) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-undeca-1,10-dien-6-ylisoindole-1,3-dione.
| Compound Name | 2-undeca-1,10-dien-6-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 11323980 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-undeca-1,10-dien-6-ylisoindole-1,3-dione |
| SMILES | C=CCCCC(CCCC=C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H23NO2/c1-3-5-7-11-15(12-8-6-4-2)20-18(21)16-13-9-10-14-17(16)19(20)22/h3-4,9-10,13-15H,1-2,5-8,11-12H2 |
| InChIKey | LDNHKCUMSBWLHU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|