C24H32OSi — CID 11175995
tert-butyl-[(2S)-1-[(1R,2R)-2-ethenylcyclopropyl]propan-2-yl]oxy-diphenylsilane (PubChem CID 11175995) has the molecular formula C24H32OSi and a molecular weight of 364.61 g/mol. Its IUPAC name is tert-butyl-[(2S)-1-[(1R,2R)-2-ethenylcyclopropyl]propan-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-1-[(1R,2R)-2-ethenylcyclopropyl]propan-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 11175995 |
| Molecular Formula | C24H32OSi |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | tert-butyl-[(2S)-1-[(1R,2R)-2-ethenylcyclopropyl]propan-2-yl]oxy-diphenylsilane |
| SMILES | C=C[C@H]1C[C@@H]1C[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H32OSi/c1-6-20-18-21(20)17-19(2)25-26(24(3,4)5,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h6-16,19-21H,1,17-18H2,2-5H3/t19-,20-,21-/m0/s1 |
| InChIKey | JABSQUSOVDIMOU-ACRUOGEOSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|