C23H33NO2Si — CID 152696618
tert-butyl-[(2R)-1-[(4S,5R)-4-methyl-1,3-oxazolidin-5-yl]propan-2-yl]oxy-diphenylsilane (PubChem CID 152696618) has the molecular formula C23H33NO2Si and a molecular weight of 383.61 g/mol. Its IUPAC name is tert-butyl-[(2R)-1-[(4S,5R)-4-methyl-1,3-oxazolidin-5-yl]propan-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2R)-1-[(4S,5R)-4-methyl-1,3-oxazolidin-5-yl]propan-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 152696618 |
| Molecular Formula | C23H33NO2Si |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | tert-butyl-[(2R)-1-[(4S,5R)-4-methyl-1,3-oxazolidin-5-yl]propan-2-yl]oxy-diphenylsilane |
| SMILES | C[C@H](C[C@H]1OCN[C@H]1C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H33NO2Si/c1-18(16-22-19(2)24-17-25-22)26-27(23(3,4)5,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,18-19,22,24H,16-17H2,1-5H3/t18-,19+,22-/m1/s1 |
| InChIKey | ZQROZTVJXISBJS-XQBPLPMBSA-N |
| XLogP | 3.68 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|