C30H48O2Si2 — CID 101428373
tert-butyl-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-4-ethylhex-5-enoxy]-diphenylsilane (PubChem CID 101428373) has the molecular formula C30H48O2Si2 and a molecular weight of 496.88 g/mol. Its IUPAC name is tert-butyl-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-4-ethylhex-5-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-4-ethylhex-5-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101428373 |
| Molecular Formula | C30H48O2Si2 |
| Molecular Weight | 496.88 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | tert-butyl-[(E)-6-[tert-butyl(dimethyl)silyl]oxy-4-ethylhex-5-enoxy]-diphenylsilane |
| SMILES | CCC(/C=C/O[Si](C)(C)C(C)(C)C)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H48O2Si2/c1-10-26(23-25-31-33(8,9)29(2,3)4)18-17-24-32-34(30(5,6)7,27-19-13-11-14-20-27)28-21-15-12-16-22-28/h11-16,19-23,25-26H,10,17-18,24H2,1-9H3/b25-23+ |
| InChIKey | XDFYVRCHJVTANY-WJTDDFOZSA-N |
| XLogP | 7.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.88 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|