C25H32O2Si — CID 53492897
(2E,4E,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]octa-2,4-dienal (PubChem CID 53492897) has the molecular formula C25H32O2Si and a molecular weight of 392.62 g/mol. Its IUPAC name is (2E,4E,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]octa-2,4-dienal.
| Compound Name | (2E,4E,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]octa-2,4-dienal |
|---|---|
| PubChem CID | 53492897 |
| Molecular Formula | C25H32O2Si |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (2E,4E,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]octa-2,4-dienal |
| SMILES | CC[C@@H](/C=C/C=C/C=O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H32O2Si/c1-5-22(15-9-8-14-20-26)21-27-28(25(2,3)4,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h6-20,22H,5,21H2,1-4H3/b14-8+,15-9+/t22-/m0/s1 |
| InChIKey | LFDVBHVVMDJAHA-COUNKINGSA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|