C34H44O4Si — CID 71726038
(Z,4S,7R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxy]non-5-en-2-one (PubChem CID 71726038) has the molecular formula C34H44O4Si and a molecular weight of 544.81 g/mol. Its IUPAC name is (Z,4S,7R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxy]non-5-en-2-one.
| Compound Name | (Z,4S,7R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxy]non-5-en-2-one |
|---|---|
| PubChem CID | 71726038 |
| Molecular Formula | C34H44O4Si |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | (Z,4S,7R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxy]non-5-en-2-one |
| SMILES | CC[C@H](/C=C\[C@H](CC(C)=O)OCc1ccc(OC)cc1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H44O4Si/c1-7-28(18-23-31(24-27(2)35)37-25-29-19-21-30(36-6)22-20-29)26-38-39(34(3,4)5,32-14-10-8-11-15-32)33-16-12-9-13-17-33/h8-23,28,31H,7,24-26H2,1-6H3/b23-18-/t28-,31-/m1/s1 |
| InChIKey | OYNITGRCHVQMDE-XGJRCDJSSA-N |
| XLogP | 6.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|