C30H36O5Si — CID 102263688
(E)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]-2-methylpent-3-enoic acid (PubChem CID 102263688) has the molecular formula C30H36O5Si and a molecular weight of 504.70 g/mol. Its IUPAC name is (E)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]-2-methylpent-3-enoic acid.
| Compound Name | (E)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]-2-methylpent-3-enoic acid |
|---|---|
| PubChem CID | 102263688 |
| Molecular Formula | C30H36O5Si |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | (E)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]-2-methylpent-3-enoic acid |
| SMILES | COc1ccc(COC(C)(/C=C/CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C30H36O5Si/c1-29(2,3)36(26-13-8-6-9-14-26,27-15-10-7-11-16-27)35-22-12-21-30(4,28(31)32)34-23-24-17-19-25(33-5)20-18-24/h6-21H,22-23H2,1-5H3,(H,31,32)/b21-12+ |
| InChIKey | UYWLGNBTTKBODQ-CIAFOILYSA-N |
| XLogP | 5.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|