C41H56O5Si2 — CID 134973938
methyl (E,2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(4-methoxyphenyl)methoxy]-3-methyl-2-[(2R)-2-methyl-4-trimethylsilylbut-3-ynyl]hex-4-enoate (PubChem CID 134973938) has the molecular formula C41H56O5Si2 and a molecular weight of 685.07 g/mol. Its IUPAC name is methyl (E,2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(4-methoxyphenyl)methoxy]-3-methyl-2-[(2R)-2-methyl-4-trimethylsilylbut-3-ynyl]hex-4-enoate.
| Compound Name | methyl (E,2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(4-methoxyphenyl)methoxy]-3-methyl-2-[(2R)-2-methyl-4-trimethylsilylbut-3-ynyl]hex-4-enoate |
|---|---|
| PubChem CID | 134973938 |
| Molecular Formula | C41H56O5Si2 |
| Molecular Weight | 685.07 g/mol |
| Exact Mass | 684.37 |
| IUPAC Name | methyl (E,2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(4-methoxyphenyl)methoxy]-3-methyl-2-[(2R)-2-methyl-4-trimethylsilylbut-3-ynyl]hex-4-enoate |
| SMILES | C/C=C/[C@@](C)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@](C[C@@H](C)C#C[Si](C)(C)C)(OCc1ccc(OC)cc1)C(=O)OC |
| InChI | InChI=1S/C41H56O5Si2/c1-12-28-40(6,32-46-48(39(3,4)5,36-19-15-13-16-20-36)37-21-17-14-18-22-37)41(38(42)44-8,30-33(2)27-29-47(9,10)11)45-31-34-23-25-35(43-7)26-24-34/h12-26,28,33H,30-32H2,1-11H3/b28-12+/t33-,40-,41+/m0/s1 |
| InChIKey | SRTTXTPVJPSEON-ZCZQGTRZSA-N |
| XLogP | 8.19 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.07 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|