C34H42O5Si — CID 102211158
methyl (1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxy]-2-methylcyclohex-3-ene-1-carboxylate (PubChem CID 102211158) has the molecular formula C34H42O5Si and a molecular weight of 558.79 g/mol. Its IUPAC name is methyl (1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxy]-2-methylcyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxy]-2-methylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102211158 |
| Molecular Formula | C34H42O5Si |
| Molecular Weight | 558.79 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | methyl (1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxy]-2-methylcyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(OCc2ccc(OC)cc2)CCC=C[C@]1(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H42O5Si/c1-32(2,3)40(29-15-9-7-10-16-29,30-17-11-8-12-18-30)39-26-33(4)23-13-14-24-34(33,31(35)37-6)38-25-27-19-21-28(36-5)22-20-27/h7-13,15-23H,14,24-26H2,1-6H3/t33-,34-/m1/s1 |
| InChIKey | UXVZZJKJAIIXHI-KKLWWLSJSA-N |
| XLogP | 6.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.79 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|