C32H38O5Si — CID 102211154
methyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxy]cyclopent-3-ene-1-carboxylate (PubChem CID 102211154) has the molecular formula C32H38O5Si and a molecular weight of 530.74 g/mol. Its IUPAC name is methyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxy]cyclopent-3-ene-1-carboxylate.
| Compound Name | methyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxy]cyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102211154 |
| Molecular Formula | C32H38O5Si |
| Molecular Weight | 530.74 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | methyl (1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methoxy]cyclopent-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(OCc2ccc(OC)cc2)CC=C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H38O5Si/c1-31(2,3)38(28-14-8-6-9-15-28,29-16-10-7-11-17-29)37-24-26-13-12-22-32(26,30(33)35-5)36-23-25-18-20-27(34-4)21-19-25/h6-21,26H,22-24H2,1-5H3/t26-,32-/m0/s1 |
| InChIKey | UREURCKLTYSRIV-IEWVHIKDSA-N |
| XLogP | 5.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.74 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|