C30H38O4Si — CID 11179358
(3R)-5-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-3-methylpentan-2-one (PubChem CID 11179358) has the molecular formula C30H38O4Si and a molecular weight of 490.72 g/mol. Its IUPAC name is (3R)-5-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-3-methylpentan-2-one.
| Compound Name | (3R)-5-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-3-methylpentan-2-one |
|---|---|
| PubChem CID | 11179358 |
| Molecular Formula | C30H38O4Si |
| Molecular Weight | 490.72 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | (3R)-5-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-3-methylpentan-2-one |
| SMILES | COc1ccc(CO[C@](C)(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(C)=O)cc1 |
| InChI | InChI=1S/C30H38O4Si/c1-24(31)30(5,33-23-25-17-19-26(32-6)20-18-25)21-22-34-35(29(2,3)4,27-13-9-7-10-14-27)28-15-11-8-12-16-28/h7-20H,21-23H2,1-6H3/t30-/m1/s1 |
| InChIKey | JJDSXNGGMAKLCQ-SSEXGKCCSA-N |
| XLogP | 5.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.72 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|