C35H48O6Si — CID 100990270
tert-butyl (2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxymethoxy]-2-methylbutanoate (PubChem CID 100990270) has the molecular formula C35H48O6Si and a molecular weight of 592.85 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxymethoxy]-2-methylbutanoate.
| Compound Name | tert-butyl (2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxymethoxy]-2-methylbutanoate |
|---|---|
| PubChem CID | 100990270 |
| Molecular Formula | C35H48O6Si |
| Molecular Weight | 592.85 g/mol |
| Exact Mass | 592.32 |
| IUPAC Name | tert-butyl (2S,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(4-methoxyphenyl)methoxymethoxy]-2-methylbutanoate |
| SMILES | COc1ccc(COCOC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C35H48O6Si/c1-27(33(36)41-34(2,3)4)29(24-39-26-38-23-28-19-21-30(37-8)22-20-28)25-40-42(35(5,6)7,31-15-11-9-12-16-31)32-17-13-10-14-18-32/h9-22,27,29H,23-26H2,1-8H3/t27-,29-/m0/s1 |
| InChIKey | AXGBWIVRWCRSHF-YTMVLYRLSA-N |
| XLogP | 6.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.85 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|