C43H64O6Si2 — CID 11251170
(E,2R,4R,5S,8R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-1-[(4-methoxyphenyl)methoxy]-2,6,8-trimethylnon-6-en-3-one (PubChem CID 11251170) has the molecular formula C43H64O6Si2 and a molecular weight of 733.15 g/mol. Its IUPAC name is (E,2R,4R,5S,8R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-1-[(4-methoxyphenyl)methoxy]-2,6,8-trimethylnon-6-en-3-one.
| Compound Name | (E,2R,4R,5S,8R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-1-[(4-methoxyphenyl)methoxy]-2,6,8-trimethylnon-6-en-3-one |
|---|---|
| PubChem CID | 11251170 |
| Molecular Formula | C43H64O6Si2 |
| Molecular Weight | 733.15 g/mol |
| Exact Mass | 732.42 |
| IUPAC Name | (E,2R,4R,5S,8R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-1-[(4-methoxyphenyl)methoxy]-2,6,8-trimethylnon-6-en-3-one |
| SMILES | COc1ccc(COC[C@@H](C)C(=O)[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)/C(C)=C/[C@@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C43H64O6Si2/c1-32(28-49-51(43(7,8)9,37-19-15-13-16-20-37)38-21-17-14-18-22-38)27-33(2)40(44)39(31-48-50(11,12)42(4,5)6)41(45)34(3)29-47-30-35-23-25-36(46-10)26-24-35/h13-27,32,34,39-40,44H,28-31H2,1-12H3/b33-27+/t32-,34-,39-,40-/m1/s1 |
| InChIKey | OQFXPPJLRAEKBB-WXIWBHNOSA-N |
| XLogP | 8.57 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.15 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|