C37H44O5Si — CID 11753665
(3S,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3-phenylmethoxyhexan-2-one (PubChem CID 11753665) has the molecular formula C37H44O5Si and a molecular weight of 596.84 g/mol. Its IUPAC name is (3S,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3-phenylmethoxyhexan-2-one.
| Compound Name | (3S,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3-phenylmethoxyhexan-2-one |
|---|---|
| PubChem CID | 11753665 |
| Molecular Formula | C37H44O5Si |
| Molecular Weight | 596.84 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | (3S,4S)-6-[tert-butyl(diphenyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3-phenylmethoxyhexan-2-one |
| SMILES | COc1ccc(CO[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](OCc2ccccc2)C(C)=O)cc1 |
| InChI | InChI=1S/C37H44O5Si/c1-29(38)36(41-28-30-15-9-6-10-16-30)35(40-27-31-21-23-32(39-5)24-22-31)25-26-42-43(37(2,3)4,33-17-11-7-12-18-33)34-19-13-8-14-20-34/h6-24,35-36H,25-28H2,1-5H3/t35-,36+/m0/s1 |
| InChIKey | JAWMNCRFBGYIMJ-MPQUPPDSSA-N |
| XLogP | 6.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.84 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|