C29H36O4Si — CID 75162787
5-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]pentanal (PubChem CID 75162787) has the molecular formula C29H36O4Si and a molecular weight of 476.69 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]pentanal.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]pentanal |
|---|---|
| PubChem CID | 75162787 |
| Molecular Formula | C29H36O4Si |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]pentanal |
| SMILES | COc1ccc(COC(CC=O)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H36O4Si/c1-29(2,3)34(27-11-7-5-8-12-27,28-13-9-6-10-14-28)33-22-20-26(19-21-30)32-23-24-15-17-25(31-4)18-16-24/h5-18,21,26H,19-20,22-23H2,1-4H3 |
| InChIKey | BSCVKXBXSIONHH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|