C42H48O5Si — CID 101226506
[(3S)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-3-methoxybutoxy]-tert-butyl-diphenylsilane (PubChem CID 101226506) has the molecular formula C42H48O5Si and a molecular weight of 660.93 g/mol. Its IUPAC name is [(3S)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-3-methoxybutoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(3S)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-3-methoxybutoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 101226506 |
| Molecular Formula | C42H48O5Si |
| Molecular Weight | 660.93 g/mol |
| Exact Mass | 660.33 |
| IUPAC Name | [(3S)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-3-methoxybutoxy]-tert-butyl-diphenylsilane |
| SMILES | COc1ccc(C(OC[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H48O5Si/c1-41(2,3)48(39-18-12-8-13-19-39,40-20-14-9-15-21-40)47-31-30-38(45-6)32-46-42(33-16-10-7-11-17-33,34-22-26-36(43-4)27-23-34)35-24-28-37(44-5)29-25-35/h7-29,38H,30-32H2,1-6H3/t38-/m0/s1 |
| InChIKey | JUELMRIZKFQVGV-LHEWISCISA-N |
| XLogP | 7.99 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.93 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|