C45H57NO4Si2 — CID 140800503
(2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]-N-[(2,4-dimethoxyphenyl)methyl]butan-2-amine (PubChem CID 140800503) has the molecular formula C45H57NO4Si2 and a molecular weight of 732.13 g/mol. Its IUPAC name is (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]-N-[(2,4-dimethoxyphenyl)methyl]butan-2-amine.
| Compound Name | (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]-N-[(2,4-dimethoxyphenyl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 140800503 |
| Molecular Formula | C45H57NO4Si2 |
| Molecular Weight | 732.13 g/mol |
| Exact Mass | 731.38 |
| IUPAC Name | (2S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]-N-[(2,4-dimethoxyphenyl)methyl]butan-2-amine |
| SMILES | COc1ccc(CN[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C45H57NO4Si2/c1-44(2,3)51(39-21-13-9-14-22-39,40-23-15-10-16-24-40)49-32-31-37(46-34-36-29-30-38(47-7)33-43(36)48-8)35-50-52(45(4,5)6,41-25-17-11-18-26-41)42-27-19-12-20-28-42/h9-30,33,37,46H,31-32,34-35H2,1-8H3/t37-/m0/s1 |
| InChIKey | UDHUGIFOWBLMCR-QNGWXLTQSA-N |
| XLogP | 7.71 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.13 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|