C41H49NO8Si — CID 5461248
[(4R)-4-(3-acetamido-2-methoxyphenyl)-5-[tert-butyl(diphenyl)silyl]oxy-3-[(2,4-dimethoxyphenyl)methyl]-2-oxopentyl] acetate (PubChem CID 5461248) has the molecular formula C41H49NO8Si and a molecular weight of 711.93 g/mol. Its IUPAC name is [(4R)-4-(3-acetamido-2-methoxyphenyl)-5-[tert-butyl(diphenyl)silyl]oxy-3-[(2,4-dimethoxyphenyl)methyl]-2-oxopentyl] acetate.
| Compound Name | [(4R)-4-(3-acetamido-2-methoxyphenyl)-5-[tert-butyl(diphenyl)silyl]oxy-3-[(2,4-dimethoxyphenyl)methyl]-2-oxopentyl] acetate |
|---|---|
| PubChem CID | 5461248 |
| Molecular Formula | C41H49NO8Si |
| Molecular Weight | 711.93 g/mol |
| Exact Mass | 711.32 |
| IUPAC Name | [(4R)-4-(3-acetamido-2-methoxyphenyl)-5-[tert-butyl(diphenyl)silyl]oxy-3-[(2,4-dimethoxyphenyl)methyl]-2-oxopentyl] acetate |
| SMILES | COc1ccc(CC(C(=O)COC(C)=O)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c2cccc(NC(C)=O)c2OC)c(OC)c1 |
| InChI | InChI=1S/C41H49NO8Si/c1-28(43)42-37-21-15-20-34(40(37)48-8)36(35(38(45)27-49-29(2)44)24-30-22-23-31(46-6)25-39(30)47-7)26-50-51(41(3,4)5,32-16-11-9-12-17-32)33-18-13-10-14-19-33/h9-23,25,35-36H,24,26-27H2,1-8H3,(H,42,43)/t35?,36-/m0/s1 |
| InChIKey | XWYSRHWEZZSBHR-UHBYFKDRSA-N |
| XLogP | 6.32 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.93 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|