C28H40O4Si — CID 102034226
ethyl (2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-2-(2-oxopropyl)pentanoate (PubChem CID 102034226) has the molecular formula C28H40O4Si and a molecular weight of 468.71 g/mol. Its IUPAC name is ethyl (2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-2-(2-oxopropyl)pentanoate.
| Compound Name | ethyl (2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-2-(2-oxopropyl)pentanoate |
|---|---|
| PubChem CID | 102034226 |
| Molecular Formula | C28H40O4Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | ethyl (2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-2-(2-oxopropyl)pentanoate |
| SMILES | CCOC(=O)[C@@H](CC(C)=O)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C28H40O4Si/c1-8-31-27(30)25(19-22(4)29)26(21(2)3)20-32-33(28(5,6)7,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,21,25-26H,8,19-20H2,1-7H3/t25-,26+/m0/s1 |
| InChIKey | KVAOIKFCSKGDSH-IZZNHLLZSA-N |
| XLogP | 4.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|