C27H38O3Si — CID 90724731
ethyl (6S)-7-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethylhept-2-enoate (PubChem CID 90724731) has the molecular formula C27H38O3Si and a molecular weight of 438.68 g/mol. Its IUPAC name is ethyl (6S)-7-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethylhept-2-enoate.
| Compound Name | ethyl (6S)-7-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethylhept-2-enoate |
|---|---|
| PubChem CID | 90724731 |
| Molecular Formula | C27H38O3Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | ethyl (6S)-7-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethylhept-2-enoate |
| SMILES | CCOC(=O)C(C)=CCC[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H38O3Si/c1-7-29-26(28)23(3)16-14-15-22(2)21-30-31(27(4,5)6,24-17-10-8-11-18-24)25-19-12-9-13-20-25/h8-13,16-20,22H,7,14-15,21H2,1-6H3/t22-/m0/s1 |
| InChIKey | UKZOVWPTAUGNSR-QFIPXVFZSA-N |
| XLogP | 5.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|