C35H44O5SSi — CID 11578024
ethyl (E,6S,7S)-8-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethyl-7-phenoxycarbothioyloxyoct-2-enoate (PubChem CID 11578024) has the molecular formula C35H44O5SSi and a molecular weight of 604.89 g/mol. Its IUPAC name is ethyl (E,6S,7S)-8-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethyl-7-phenoxycarbothioyloxyoct-2-enoate.
| Compound Name | ethyl (E,6S,7S)-8-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethyl-7-phenoxycarbothioyloxyoct-2-enoate |
|---|---|
| PubChem CID | 11578024 |
| Molecular Formula | C35H44O5SSi |
| Molecular Weight | 604.89 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | ethyl (E,6S,7S)-8-[tert-butyl(diphenyl)silyl]oxy-2,6-dimethyl-7-phenoxycarbothioyloxyoct-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/CC[C@H](C)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=S)Oc1ccccc1 |
| InChI | InChI=1S/C35H44O5SSi/c1-7-37-33(36)28(3)19-17-18-27(2)32(40-34(41)39-29-20-11-8-12-21-29)26-38-42(35(4,5)6,30-22-13-9-14-23-30)31-24-15-10-16-25-31/h8-16,19-25,27,32H,7,17-18,26H2,1-6H3/b28-19+/t27-,32+/m0/s1 |
| InChIKey | UBAIHPATFKZSBF-FRDNJSGTSA-N |
| XLogP | 7.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.89 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|