C35H55NO5Si2 — CID 11215767
ethyl (E,4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-4-[[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoyl]amino]-2,5-dimethylhex-2-enoate (PubChem CID 11215767) has the molecular formula C35H55NO5Si2 and a molecular weight of 626.00 g/mol. Its IUPAC name is ethyl (E,4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-4-[[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoyl]amino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E,4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-4-[[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoyl]amino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 11215767 |
| Molecular Formula | C35H55NO5Si2 |
| Molecular Weight | 626.00 g/mol |
| Exact Mass | 625.36 |
| IUPAC Name | ethyl (E,4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-4-[[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoyl]amino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](NC(=O)[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H55NO5Si2/c1-13-39-33(38)26(2)24-31(27(3)25-40-42(11,12)34(5,6)7)36-32(37)28(4)41-43(35(8,9)10,29-20-16-14-17-21-29)30-22-18-15-19-23-30/h14-24,27-28,31H,13,25H2,1-12H3,(H,36,37)/b26-24+/t27-,28+,31-/m1/s1 |
| InChIKey | KTUBWDSBTZNZLW-BNMMBFGTSA-N |
| XLogP | 6.60 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.00 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|