C25H32O6Si — CID 10072767
[(2S,3S)-3-acetyloxy-1-[tert-butyl(diphenyl)silyl]oxy-4-oxopentan-2-yl] acetate (PubChem CID 10072767) has the molecular formula C25H32O6Si and a molecular weight of 456.61 g/mol. Its IUPAC name is [(2S,3S)-3-acetyloxy-1-[tert-butyl(diphenyl)silyl]oxy-4-oxopentan-2-yl] acetate.
| Compound Name | [(2S,3S)-3-acetyloxy-1-[tert-butyl(diphenyl)silyl]oxy-4-oxopentan-2-yl] acetate |
|---|---|
| PubChem CID | 10072767 |
| Molecular Formula | C25H32O6Si |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | [(2S,3S)-3-acetyloxy-1-[tert-butyl(diphenyl)silyl]oxy-4-oxopentan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](OC(C)=O)C(C)=O |
| InChI | InChI=1S/C25H32O6Si/c1-18(26)24(31-20(3)28)23(30-19(2)27)17-29-32(25(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,23-24H,17H2,1-6H3/t23-,24+/m0/s1 |
| InChIKey | VNTCFKPCGMTQAC-BJKOFHAPSA-N |
| XLogP | 3.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|