C50H53BrO7 — CID 139633696
1-[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(5-bromopentoxy)propoxy]-(4-methoxyphenyl)-phenylmethyl]-4-methoxybenzene (PubChem CID 139633696) has the molecular formula C50H53BrO7 and a molecular weight of 845.87 g/mol. Its IUPAC name is 1-[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(5-bromopentoxy)propoxy]-(4-methoxyphenyl)-phenylmethyl]-4-methoxybenzene.
| Compound Name | 1-[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(5-bromopentoxy)propoxy]-(4-methoxyphenyl)-phenylmethyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 139633696 |
| Molecular Formula | C50H53BrO7 |
| Molecular Weight | 845.87 g/mol |
| Exact Mass | 844.30 |
| IUPAC Name | 1-[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(5-bromopentoxy)propoxy]-(4-methoxyphenyl)-phenylmethyl]-4-methoxybenzene |
| SMILES | COc1ccc(C(OCC(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)OCCCCCBr)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C50H53BrO7/c1-52-44-26-18-40(19-27-44)49(38-14-8-5-9-15-38,41-20-28-45(53-2)29-21-41)57-36-48(56-35-13-7-12-34-51)37-58-50(39-16-10-6-11-17-39,42-22-30-46(54-3)31-23-42)43-24-32-47(55-4)33-25-43/h5-6,8-11,14-33,48H,7,12-13,34-37H2,1-4H3 |
| InChIKey | HVXWOJOAOBPIPP-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.87 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|