C31H40O3S — CID 10051358
(2R)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-octoxypropane-2-thiol (PubChem CID 10051358) has the molecular formula C31H40O3S and a molecular weight of 492.73 g/mol. Its IUPAC name is (2R)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-octoxypropane-2-thiol.
| Compound Name | (2R)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-octoxypropane-2-thiol |
|---|---|
| PubChem CID | 10051358 |
| Molecular Formula | C31H40O3S |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (2R)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-octoxypropane-2-thiol |
| SMILES | CCCCCCCCOC[C@@H](S)COC(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C31H40O3S/c1-3-4-5-6-7-14-23-33-24-30(35)25-34-31(26-15-10-8-11-16-26,27-17-12-9-13-18-27)28-19-21-29(32-2)22-20-28/h8-13,15-22,30,35H,3-7,14,23-25H2,1-2H3/t30-/m1/s1 |
| InChIKey | JRSFVXZDOQQQCF-SSEXGKCCSA-N |
| XLogP | 7.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|