C30H38O3 — CID 67230477
(2R)-1-octoxy-3-trityloxypropan-2-ol (PubChem CID 67230477) has the molecular formula C30H38O3 and a molecular weight of 446.63 g/mol. Its IUPAC name is (2R)-1-octoxy-3-trityloxypropan-2-ol.
| Compound Name | (2R)-1-octoxy-3-trityloxypropan-2-ol |
|---|---|
| PubChem CID | 67230477 |
| Molecular Formula | C30H38O3 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | (2R)-1-octoxy-3-trityloxypropan-2-ol |
| SMILES | CCCCCCCCOC[C@@H](O)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H38O3/c1-2-3-4-5-6-16-23-32-24-29(31)25-33-30(26-17-10-7-11-18-26,27-19-12-8-13-20-27)28-21-14-9-15-22-28/h7-15,17-22,29,31H,2-6,16,23-25H2,1H3/t29-/m1/s1 |
| InChIKey | NQDWZCLRSWHLPZ-GDLZYMKVSA-N |
| XLogP | 6.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|