C64H82O6 — CID 88631148
(2R,3S,4S,5R)-2,5-didecoxy-1,6-ditrityloxyhexane-3,4-diol (PubChem CID 88631148) has the molecular formula C64H82O6 and a molecular weight of 947.35 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,5-didecoxy-1,6-ditrityloxyhexane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2,5-didecoxy-1,6-ditrityloxyhexane-3,4-diol |
|---|---|
| PubChem CID | 88631148 |
| Molecular Formula | C64H82O6 |
| Molecular Weight | 947.35 g/mol |
| Exact Mass | 946.61 |
| IUPAC Name | (2R,3S,4S,5R)-2,5-didecoxy-1,6-ditrityloxyhexane-3,4-diol |
| SMILES | CCCCCCCCCCO[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](O)[C@H](O)[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)OCCCCCCCCCC |
| InChI | InChI=1S/C64H82O6/c1-3-5-7-9-11-13-15-35-49-67-59(51-69-63(53-37-23-17-24-38-53,54-39-25-18-26-40-54)55-41-27-19-28-42-55)61(65)62(66)60(68-50-36-16-14-12-10-8-6-4-2)52-70-64(56-43-29-20-30-44-56,57-45-31-21-32-46-57)58-47-33-22-34-48-58/h17-34,37-48,59-62,65-66H,3-16,35-36,49-52H2,1-2H3/t59-,60-,61-,62-/m1/s1 |
| InChIKey | XFHYNMQQZZOYLL-QSELHXSQSA-N |
| XLogP | 14.78 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.35 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|