C36H48O3 — CID 67230401
(2R)-2-hex-5-enoxy-1-trityloxyundecan-3-ol (PubChem CID 67230401) has the molecular formula C36H48O3 and a molecular weight of 528.78 g/mol. Its IUPAC name is (2R)-2-hex-5-enoxy-1-trityloxyundecan-3-ol.
| Compound Name | (2R)-2-hex-5-enoxy-1-trityloxyundecan-3-ol |
|---|---|
| PubChem CID | 67230401 |
| Molecular Formula | C36H48O3 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.36 |
| IUPAC Name | (2R)-2-hex-5-enoxy-1-trityloxyundecan-3-ol |
| SMILES | C=CCCCCO[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)C(O)CCCCCCCC |
| InChI | InChI=1S/C36H48O3/c1-3-5-7-9-10-20-28-34(37)35(38-29-21-8-6-4-2)30-39-36(31-22-14-11-15-23-31,32-24-16-12-17-25-32)33-26-18-13-19-27-33/h4,11-19,22-27,34-35,37H,2-3,5-10,20-21,28-30H2,1H3/t34?,35-/m1/s1 |
| InChIKey | XJLUQWGWXXJUSM-ICBMVRCQSA-N |
| XLogP | 8.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|