C60H74O6 — CID 90296827
[diphenyl-[(2R,3R,4R,5R)-2,3,4,5-tetrabutoxy-6-trityloxyhexoxy]methyl]benzene (PubChem CID 90296827) has the molecular formula C60H74O6 and a molecular weight of 891.25 g/mol. Its IUPAC name is [diphenyl-[(2R,3R,4R,5R)-2,3,4,5-tetrabutoxy-6-trityloxyhexoxy]methyl]benzene.
| Compound Name | [diphenyl-[(2R,3R,4R,5R)-2,3,4,5-tetrabutoxy-6-trityloxyhexoxy]methyl]benzene |
|---|---|
| PubChem CID | 90296827 |
| Molecular Formula | C60H74O6 |
| Molecular Weight | 891.25 g/mol |
| Exact Mass | 890.55 |
| IUPAC Name | [diphenyl-[(2R,3R,4R,5R)-2,3,4,5-tetrabutoxy-6-trityloxyhexoxy]methyl]benzene |
| SMILES | CCCCO[C@@H]([C@H](OCCCC)[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)OCCCC)[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)OCCCC |
| InChI | InChI=1S/C60H74O6/c1-5-9-43-61-55(47-65-59(49-31-19-13-20-32-49,50-33-21-14-22-34-50)51-35-23-15-24-36-51)57(63-45-11-7-3)58(64-46-12-8-4)56(62-44-10-6-2)48-66-60(52-37-25-16-26-38-52,53-39-27-17-28-40-53)54-41-29-18-30-42-54/h13-42,55-58H,5-12,43-48H2,1-4H3/t55-,56-,57-,58-/m1/s1 |
| InChIKey | YWDGXHUCLVDMKQ-YBJJJAAASA-N |
| XLogP | 13.74 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.25 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|