C43H50O6Si — CID 154592632
[(2R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(2-methoxyethoxy)propoxy]-tert-butyl-diphenylsilane (PubChem CID 154592632) has the molecular formula C43H50O6Si and a molecular weight of 690.95 g/mol. Its IUPAC name is [(2R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(2-methoxyethoxy)propoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(2-methoxyethoxy)propoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 154592632 |
| Molecular Formula | C43H50O6Si |
| Molecular Weight | 690.95 g/mol |
| Exact Mass | 690.34 |
| IUPAC Name | [(2R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-(2-methoxyethoxy)propoxy]-tert-butyl-diphenylsilane |
| SMILES | COCCO[C@H](COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C43H50O6Si/c1-42(2,3)50(40-18-12-8-13-19-40,41-20-14-9-15-21-41)49-33-39(47-31-30-44-4)32-48-43(34-16-10-7-11-17-34,35-22-26-37(45-5)27-23-35)36-24-28-38(46-6)29-25-36/h7-29,39H,30-33H2,1-6H3/t39-/m1/s1 |
| InChIKey | YKNDVZXTGMCJHF-LDLOPFEMSA-N |
| XLogP | 7.62 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.95 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|