C41H46O4Si — CID 101038575
(2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-trityloxypentane-1,4-diol (PubChem CID 101038575) has the molecular formula C41H46O4Si and a molecular weight of 630.90 g/mol. Its IUPAC name is (2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-trityloxypentane-1,4-diol.
| Compound Name | (2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-trityloxypentane-1,4-diol |
|---|---|
| PubChem CID | 101038575 |
| Molecular Formula | C41H46O4Si |
| Molecular Weight | 630.90 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | (2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-trityloxypentane-1,4-diol |
| SMILES | CC(C)(C)[Si](OC[C@@H](CO)C[C@H](O)COC(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H46O4Si/c1-40(2,3)46(38-25-15-7-16-26-38,39-27-17-8-18-28-39)45-31-33(30-42)29-37(43)32-44-41(34-19-9-4-10-20-34,35-21-11-5-12-22-35)36-23-13-6-14-24-36/h4-28,33,37,42-43H,29-32H2,1-3H3/t33-,37+/m1/s1 |
| InChIKey | UGROUIBLUMSLSI-GOJCVTOHSA-N |
| XLogP | 6.93 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.90 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|