C27H30O3 — CID 45033911
(2R,4R)-2-prop-2-enyl-5-trityloxypentane-1,4-diol (PubChem CID 45033911) has the molecular formula C27H30O3 and a molecular weight of 402.53 g/mol. Its IUPAC name is (2R,4R)-2-prop-2-enyl-5-trityloxypentane-1,4-diol.
| Compound Name | (2R,4R)-2-prop-2-enyl-5-trityloxypentane-1,4-diol |
|---|---|
| PubChem CID | 45033911 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (2R,4R)-2-prop-2-enyl-5-trityloxypentane-1,4-diol |
| SMILES | C=CC[C@@H](CO)C[C@@H](O)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30O3/c1-2-12-22(20-28)19-26(29)21-30-27(23-13-6-3-7-14-23,24-15-8-4-9-16-24)25-17-10-5-11-18-25/h2-11,13-18,22,26,28-29H,1,12,19-21H2/t22-,26-/m1/s1 |
| InChIKey | PEYHTEZGGFBISE-ATIYNZHBSA-N |
| XLogP | 4.93 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|