C33H34O4 — CID 23657649
(1R,2S)-1-(3,4-dimethoxyphenyl)-2-(trityloxymethyl)pent-4-en-1-ol (PubChem CID 23657649) has the molecular formula C33H34O4 and a molecular weight of 494.63 g/mol. Its IUPAC name is (1R,2S)-1-(3,4-dimethoxyphenyl)-2-(trityloxymethyl)pent-4-en-1-ol.
| Compound Name | (1R,2S)-1-(3,4-dimethoxyphenyl)-2-(trityloxymethyl)pent-4-en-1-ol |
|---|---|
| PubChem CID | 23657649 |
| Molecular Formula | C33H34O4 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | (1R,2S)-1-(3,4-dimethoxyphenyl)-2-(trityloxymethyl)pent-4-en-1-ol |
| SMILES | C=CC[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C33H34O4/c1-4-14-26(32(34)25-21-22-30(35-2)31(23-25)36-3)24-37-33(27-15-8-5-9-16-27,28-17-10-6-11-18-28)29-19-12-7-13-20-29/h4-13,15-23,26,32,34H,1,14,24H2,2-3H3/t26-,32-/m0/s1 |
| InChIKey | QMXLCYDYLRDHFH-IEWVHIKDSA-N |
| XLogP | 6.94 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|