C23H30O6 — CID 102287543
(E,1R,2R)-1,5-bis(3,4-dimethoxyphenyl)-2-(methoxymethyl)pent-4-en-1-ol (PubChem CID 102287543) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is (E,1R,2R)-1,5-bis(3,4-dimethoxyphenyl)-2-(methoxymethyl)pent-4-en-1-ol.
| Compound Name | (E,1R,2R)-1,5-bis(3,4-dimethoxyphenyl)-2-(methoxymethyl)pent-4-en-1-ol |
|---|---|
| PubChem CID | 102287543 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (E,1R,2R)-1,5-bis(3,4-dimethoxyphenyl)-2-(methoxymethyl)pent-4-en-1-ol |
| SMILES | COC[C@@H](C/C=C/c1ccc(OC)c(OC)c1)[C@@H](O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H30O6/c1-25-15-18(23(24)17-10-12-20(27-3)22(14-17)29-5)8-6-7-16-9-11-19(26-2)21(13-16)28-4/h6-7,9-14,18,23-24H,8,15H2,1-5H3/b7-6+/t18-,23+/m1/s1 |
| InChIKey | DYVFUMMQRMNAMH-KUSROVSMSA-N |
| XLogP | 4.12 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |