C26H32O7 — CID 163006254
[2-[(3,4-dimethoxyphenyl)-hydroxymethyl]-5-(4-methoxyphenyl)pent-4-enyl] 2-(hydroxymethyl)but-2-enoate (PubChem CID 163006254) has the molecular formula C26H32O7 and a molecular weight of 456.54 g/mol. Its IUPAC name is [2-[(3,4-dimethoxyphenyl)-hydroxymethyl]-5-(4-methoxyphenyl)pent-4-enyl] 2-(hydroxymethyl)but-2-enoate.
| Compound Name | [2-[(3,4-dimethoxyphenyl)-hydroxymethyl]-5-(4-methoxyphenyl)pent-4-enyl] 2-(hydroxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 163006254 |
| Molecular Formula | C26H32O7 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | [2-[(3,4-dimethoxyphenyl)-hydroxymethyl]-5-(4-methoxyphenyl)pent-4-enyl] 2-(hydroxymethyl)but-2-enoate |
| SMILES | CC=C(CO)C(=O)OCC(CC=Cc1ccc(OC)cc1)C(O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H32O7/c1-5-19(16-27)26(29)33-17-21(8-6-7-18-9-12-22(30-2)13-10-18)25(28)20-11-14-23(31-3)24(15-20)32-4/h5-7,9-15,21,25,27-28H,8,16-17H2,1-4H3 |
| InChIKey | UKSHTLLRKNYMEI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|